C9H16O — CID 143486884
(3E)-3-(1-ethoxyethyl)penta-1,3-diene (PubChem CID 143486884) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3E)-3-(1-ethoxyethyl)penta-1,3-diene.
| Compound Name | (3E)-3-(1-ethoxyethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 143486884 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3E)-3-(1-ethoxyethyl)penta-1,3-diene |
| SMILES | C=C/C(=C\C)C(C)OCC |
| InChI | InChI=1S/C9H16O/c1-5-9(6-2)8(4)10-7-3/h5-6,8H,1,7H2,2-4H3/b9-6+ |
| InChIKey | RWJVMOJIOSDQSR-RMKNXTFCSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|