C6H8F6 — CID 161214870
1,1,2,3,3-pentafluoroprop-1-ene;prop-1-ene;hydrofluoride (PubChem CID 161214870) has the molecular formula C6H8F6 and a molecular weight of 194.12 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoroprop-1-ene;prop-1-ene;hydrofluoride.
| Compound Name | 1,1,2,3,3-pentafluoroprop-1-ene;prop-1-ene;hydrofluoride |
|---|---|
| PubChem CID | 161214870 |
| Molecular Formula | C6H8F6 |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1,1,2,3,3-pentafluoroprop-1-ene;prop-1-ene;hydrofluoride |
| SMILES | C=CC.F.FC(F)=C(F)C(F)F |
| InChI | InChI=1S/C3HF5.C3H6.FH/c4-1(2(5)6)3(7)8;1-3-2;/h2H;3H,1H2,2H3;1H |
| InChIKey | QSFFZXROMWDRHS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|