C5H7F3 — CID 135261950
1,1,2-trifluoro-3-methylbut-2-ene (PubChem CID 135261950) has the molecular formula C5H7F3 and a molecular weight of 124.10 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-methylbut-2-ene.
| Compound Name | 1,1,2-trifluoro-3-methylbut-2-ene |
|---|---|
| PubChem CID | 135261950 |
| Molecular Formula | C5H7F3 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 1,1,2-trifluoro-3-methylbut-2-ene |
| SMILES | CC(C)=C(F)C(F)F |
| InChI | InChI=1S/C5H7F3/c1-3(2)4(6)5(7)8/h5H,1-2H3 |
| InChIKey | UCKAAIUICBWPED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |