C5H2F6 — CID 154049218
1,2,3,4,5,5-hexafluoropenta-1,3-diene (PubChem CID 154049218) has the molecular formula C5H2F6 and a molecular weight of 176.06 g/mol. Its IUPAC name is 1,2,3,4,5,5-hexafluoropenta-1,3-diene.
| Compound Name | 1,2,3,4,5,5-hexafluoropenta-1,3-diene |
|---|---|
| PubChem CID | 154049218 |
| Molecular Formula | C5H2F6 |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 1,2,3,4,5,5-hexafluoropenta-1,3-diene |
| SMILES | FC=C(F)C(F)=C(F)C(F)F |
| InChI | InChI=1S/C5H2F6/c6-1-2(7)3(8)4(9)5(10)11/h1,5H |
| InChIKey | QFTXABCHBXOTBF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|