C3H2BrF3 — CID 173452706
3-bromo-1,2,3-trifluoroprop-1-ene (PubChem CID 173452706) has the molecular formula C3H2BrF3 and a molecular weight of 174.95 g/mol. Its IUPAC name is 3-bromo-1,2,3-trifluoroprop-1-ene.
| Compound Name | 3-bromo-1,2,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 173452706 |
| Molecular Formula | C3H2BrF3 |
| Molecular Weight | 174.95 g/mol |
| Exact Mass | 173.93 |
| IUPAC Name | 3-bromo-1,2,3-trifluoroprop-1-ene |
| SMILES | FC=C(F)C(F)Br |
| InChI | InChI=1S/C3H2BrF3/c4-3(7)2(6)1-5/h1,3H |
| InChIKey | UXWKNHGJKFWNAR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.95 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|