C2HBr2F3Zn — CID 175263935
dibromozinc;1,1,2-trifluoroethene (PubChem CID 175263935) has the molecular formula C2HBr2F3Zn and a molecular weight of 307.22 g/mol. Its IUPAC name is dibromozinc;1,1,2-trifluoroethene.
| Compound Name | dibromozinc;1,1,2-trifluoroethene |
|---|---|
| PubChem CID | 175263935 |
| Molecular Formula | C2HBr2F3Zn |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 303.77 |
| IUPAC Name | dibromozinc;1,1,2-trifluoroethene |
| SMILES | Br[Zn]Br.FC=C(F)F |
| InChI | InChI=1S/C2HF3.2BrH.Zn/c3-1-2(4)5;;;/h1H;2*1H;/q;;;+2/p-2 |
| InChIKey | RDIGOBBBXBALIC-UHFFFAOYSA-L |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|