C2H4ClF3O — CID 172684110
1,1,2-trifluoroethene;hydrate;hydrochloride (PubChem CID 172684110) has the molecular formula C2H4ClF3O and a molecular weight of 136.50 g/mol. Its IUPAC name is 1,1,2-trifluoroethene;hydrate;hydrochloride.
| Compound Name | 1,1,2-trifluoroethene;hydrate;hydrochloride |
|---|---|
| PubChem CID | 172684110 |
| Molecular Formula | C2H4ClF3O |
| Molecular Weight | 136.50 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | 1,1,2-trifluoroethene;hydrate;hydrochloride |
| SMILES | Cl.FC=C(F)F.O |
| InChI | InChI=1S/C2HF3.ClH.H2O/c3-1-2(4)5;;/h1H;1H;1H2 |
| InChIKey | SCKUOXIXXFQKHS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |