About 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene
3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene (PubChem CID 160832808) has the molecular formula C8H16F4O2Si
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene.
Molecular Properties
| Compound Name | 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene |
| PubChem CID | 160832808 |
| Molecular Formula | C8H16F4O2Si |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene |
| SMILES | CO[Si](C)(CCCF)OC.FC=C(F)F |
| InChI | InChI=1S/C6H15FO2Si.C2HF3/c1-8-10(3,9-2)6-4-5-7;3-1-2(4)5/h4-6H2,1-3H3;1H |
| InChIKey | SHADSKDFKBNCCZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene?
The IUPAC name of 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene (CID 160832808) is 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene.
What is the SMILES notation for 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene?
The canonical SMILES for 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene is CO[Si](C)(CCCF)OC.FC=C(F)F.
What is the InChIKey of 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene?
The InChIKey is SHADSKDFKBNCCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15FO2Si.C2HF3/c1-8-10(3,9-2)6-4-5-7;3-1-2(4)5/h4-6H2,1-3H3;1H.
What are the key properties of 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene?
3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene has a molecular weight of 248.29 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene is sourced from PubChem (CID 160832808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).