C8H16F4O2Si — CID 160832808
3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene (PubChem CID 160832808) has the molecular formula C8H16F4O2Si and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene.
| Compound Name | 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene |
|---|---|
| PubChem CID | 160832808 |
| Molecular Formula | C8H16F4O2Si |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-fluoropropyl-dimethoxy-methylsilane;1,1,2-trifluoroethene |
| SMILES | CO[Si](C)(CCCF)OC.FC=C(F)F |
| InChI | InChI=1S/C6H15FO2Si.C2HF3/c1-8-10(3,9-2)6-4-5-7;3-1-2(4)5/h4-6H2,1-3H3;1H |
| InChIKey | SHADSKDFKBNCCZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|