About 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile
3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile (PubChem CID 158169022) has the molecular formula C8H16N2O3Si
and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile.
Molecular Properties
| Compound Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile |
| PubChem CID | 158169022 |
| Molecular Formula | C8H16N2O3Si |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile |
| SMILES | CO[Si](C)(CCCO)OC.N#CC#N |
| InChI | InChI=1S/C6H16O3Si.C2N2/c1-8-10(3,9-2)6-4-5-7;3-1-2-4/h7H,4-6H2,1-3H3; |
| InChIKey | FXFIYJYDFYNZLM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile?
The IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile (CID 158169022) is 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile.
What is the SMILES notation for 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile?
The canonical SMILES for 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile is CO[Si](C)(CCCO)OC.N#CC#N.
What is the InChIKey of 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile?
The InChIKey is FXFIYJYDFYNZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C2N2/c1-8-10(3,9-2)6-4-5-7;3-1-2-4/h7H,4-6H2,1-3H3;.
What are the key properties of 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile?
3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile has a molecular weight of 216.31 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethoxy(methyl)silyl]propan-1-ol;oxalonitrile is sourced from PubChem (CID 158169022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).