About 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine
3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine (PubChem CID 175296488) has the molecular formula C10H27NO4Si
and a molecular weight of 253.41 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine.
Molecular Properties
| Compound Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine |
| PubChem CID | 175296488 |
| Molecular Formula | C10H27NO4Si |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine |
| SMILES | COCC(C)N.CO[Si](C)(CCCO)OC |
| InChI | InChI=1S/C6H16O3Si.C4H11NO/c1-8-10(3,9-2)6-4-5-7;1-4(5)3-6-2/h7H,4-6H2,1-3H3;4H,3,5H2,1-2H3 |
| InChIKey | NZBVARGTDQHAFJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine?
The IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine (CID 175296488) is 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine.
What is the SMILES notation for 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine?
The canonical SMILES for 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine is COCC(C)N.CO[Si](C)(CCCO)OC.
What is the InChIKey of 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine?
The InChIKey is NZBVARGTDQHAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C4H11NO/c1-8-10(3,9-2)6-4-5-7;1-4(5)3-6-2/h7H,4-6H2,1-3H3;4H,3,5H2,1-2H3.
What are the key properties of 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine?
3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine has a molecular weight of 253.41 g/mol, XLogP of 0.71, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethoxy(methyl)silyl]propan-1-ol;1-methoxypropan-2-amine is sourced from PubChem (CID 175296488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).