About 1-methoxypropan-2-amine;prop-2-yn-1-ol
1-methoxypropan-2-amine;prop-2-yn-1-ol (PubChem CID 145189711) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 1-methoxypropan-2-amine;prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 1-methoxypropan-2-amine;prop-2-yn-1-ol |
| PubChem CID | 145189711 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 1-methoxypropan-2-amine;prop-2-yn-1-ol |
| SMILES | C#CCO.COCC(C)N |
| InChI | InChI=1S/C4H11NO.C3H4O/c1-4(5)3-6-2;1-2-3-4/h4H,3,5H2,1-2H3;1,4H,3H2 |
| InChIKey | YTZABHCEFDBZNH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropan-2-amine;prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-amine;prop-2-yn-1-ol?
The IUPAC name of 1-methoxypropan-2-amine;prop-2-yn-1-ol (CID 145189711) is 1-methoxypropan-2-amine;prop-2-yn-1-ol.
What is the SMILES notation for 1-methoxypropan-2-amine;prop-2-yn-1-ol?
The canonical SMILES for 1-methoxypropan-2-amine;prop-2-yn-1-ol is C#CCO.COCC(C)N.
What is the InChIKey of 1-methoxypropan-2-amine;prop-2-yn-1-ol?
The InChIKey is YTZABHCEFDBZNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C3H4O/c1-4(5)3-6-2;1-2-3-4/h4H,3,5H2,1-2H3;1,4H,3H2.
What are the key properties of 1-methoxypropan-2-amine;prop-2-yn-1-ol?
1-methoxypropan-2-amine;prop-2-yn-1-ol has a molecular weight of 145.20 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-amine;prop-2-yn-1-ol is sourced from PubChem (CID 145189711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).