About 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane
3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane (PubChem CID 174932169) has the molecular formula C6H19NO5Si2
and a molecular weight of 241.39 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane.
Molecular Properties
| Compound Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane |
| PubChem CID | 174932169 |
| Molecular Formula | C6H19NO5Si2 |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane |
| SMILES | CO[Si](C)(CCCO)OC.O=[N+]([O-])[SiH3] |
| InChI | InChI=1S/C6H16O3Si.H3NO2Si/c1-8-10(3,9-2)6-4-5-7;2-1(3)4/h7H,4-6H2,1-3H3;4H3 |
| InChIKey | VMFROPBFBLNTMJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane?
The IUPAC name of 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane (CID 174932169) is 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane.
What is the SMILES notation for 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane?
The canonical SMILES for 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane is CO[Si](C)(CCCO)OC.O=[N+]([O-])[SiH3].
What is the InChIKey of 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane?
The InChIKey is VMFROPBFBLNTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.H3NO2Si/c1-8-10(3,9-2)6-4-5-7;2-1(3)4/h7H,4-6H2,1-3H3;4H3.
What are the key properties of 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane?
3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane has a molecular weight of 241.39 g/mol, XLogP of -0.72, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethoxy(methyl)silyl]propan-1-ol;nitrosilane is sourced from PubChem (CID 174932169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).