C19H42O5Si2 — CID 87595576
1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one (PubChem CID 87595576) has the molecular formula C19H42O5Si2 and a molecular weight of 406.71 g/mol. Its IUPAC name is 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one.
| Compound Name | 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one |
|---|---|
| PubChem CID | 87595576 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one |
| SMILES | CO[Si](C)(CCCCC(C)C(=O)C(C)CCCC[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C19H42O5Si2/c1-17(13-9-11-15-25(7,21-3)22-4)19(20)18(2)14-10-12-16-26(8,23-5)24-6/h17-18H,9-16H2,1-8H3 |
| InChIKey | FVTGHCLWRZUQFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|