About 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one
1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one (PubChem CID 87595576) has the molecular formula C19H42O5Si2
and a molecular weight of 406.71 g/mol. Its IUPAC name is 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one.
Molecular Properties
| Compound Name | 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one |
| PubChem CID | 87595576 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one |
| SMILES | CO[Si](C)(CCCCC(C)C(=O)C(C)CCCC[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C19H42O5Si2/c1-17(13-9-11-15-25(7,21-3)22-4)19(20)18(2)14-10-12-16-26(8,23-5)24-6/h17-18H,9-16H2,1-8H3 |
| InChIKey | FVTGHCLWRZUQFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one?
The IUPAC name of 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one (CID 87595576) is 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one.
What is the SMILES notation for 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one?
The canonical SMILES for 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one is CO[Si](C)(CCCCC(C)C(=O)C(C)CCCC[Si](C)(OC)OC)OC.
What is the InChIKey of 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one?
The InChIKey is FVTGHCLWRZUQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42O5Si2/c1-17(13-9-11-15-25(7,21-3)22-4)19(20)18(2)14-10-12-16-26(8,23-5)24-6/h17-18H,9-16H2,1-8H3.
What are the key properties of 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one?
1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one has a molecular weight of 406.71 g/mol, XLogP of 4.90, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,11-bis[dimethoxy(methyl)silyl]-5,7-dimethylundecan-6-one is sourced from PubChem (CID 87595576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).