C23H50O7Si2 — CID 87593623
4,6-dimethyl-1,9-bis(triethoxysilyl)nonan-5-one (PubChem CID 87593623) has the molecular formula C23H50O7Si2 and a molecular weight of 494.82 g/mol. Its IUPAC name is 4,6-dimethyl-1,9-bis(triethoxysilyl)nonan-5-one.
| Compound Name | 4,6-dimethyl-1,9-bis(triethoxysilyl)nonan-5-one |
|---|---|
| PubChem CID | 87593623 |
| Molecular Formula | C23H50O7Si2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 4,6-dimethyl-1,9-bis(triethoxysilyl)nonan-5-one |
| SMILES | CCO[Si](CCCC(C)C(=O)C(C)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C23H50O7Si2/c1-9-25-31(26-10-2,27-11-3)19-15-17-21(7)23(24)22(8)18-16-20-32(28-12-4,29-13-5)30-14-6/h21-22H,9-20H2,1-8H3 |
| InChIKey | GFWDSRKWXYDBTH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|