C29H62O7Si2 — CID 87594295
7,9-dimethyl-1,15-bis(triethoxysilyl)pentadecan-8-one (PubChem CID 87594295) has the molecular formula C29H62O7Si2 and a molecular weight of 578.98 g/mol. Its IUPAC name is 7,9-dimethyl-1,15-bis(triethoxysilyl)pentadecan-8-one.
| Compound Name | 7,9-dimethyl-1,15-bis(triethoxysilyl)pentadecan-8-one |
|---|---|
| PubChem CID | 87594295 |
| Molecular Formula | C29H62O7Si2 |
| Molecular Weight | 578.98 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | 7,9-dimethyl-1,15-bis(triethoxysilyl)pentadecan-8-one |
| SMILES | CCO[Si](CCCCCCC(C)C(=O)C(C)CCCCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C29H62O7Si2/c1-9-31-37(32-10-2,33-11-3)25-21-17-15-19-23-27(7)29(30)28(8)24-20-16-18-22-26-38(34-12-4,35-13-5)36-14-6/h27-28H,9-26H2,1-8H3 |
| InChIKey | ICRHYMMNXCEBII-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.98 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|