C21H46O7Si2 — CID 87595275
6,8-dimethyl-1,13-bis(trimethoxysilyl)tridecan-7-one (PubChem CID 87595275) has the molecular formula C21H46O7Si2 and a molecular weight of 466.76 g/mol. Its IUPAC name is 6,8-dimethyl-1,13-bis(trimethoxysilyl)tridecan-7-one.
| Compound Name | 6,8-dimethyl-1,13-bis(trimethoxysilyl)tridecan-7-one |
|---|---|
| PubChem CID | 87595275 |
| Molecular Formula | C21H46O7Si2 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 6,8-dimethyl-1,13-bis(trimethoxysilyl)tridecan-7-one |
| SMILES | CO[Si](CCCCCC(C)C(=O)C(C)CCCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C21H46O7Si2/c1-19(15-11-9-13-17-29(23-3,24-4)25-5)21(22)20(2)16-12-10-14-18-30(26-6,27-7)28-8/h19-20H,9-18H2,1-8H3 |
| InChIKey | ZADHJNBPAUHKNG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|