About trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane
trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane (PubChem CID 87481356) has the molecular formula C20H52O12Si4
and a molecular weight of 596.97 g/mol. Its IUPAC name is trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane.
Molecular Properties
| Compound Name | trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane |
| PubChem CID | 87481356 |
| Molecular Formula | C20H52O12Si4 |
| Molecular Weight | 596.97 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane |
| SMILES | CO[Si](CCCCCC[Si](OC)(OC)OC)(OC)OC.CO[Si](OC)(OC)C(C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H30O6Si2.C8H22O6Si2/c1-13-19(14-2,15-3)11-9-7-8-10-12-20(16-4,17-5)18-6;1-8(15(9-2,10-3)11-4)16(12-5,13-6)14-7/h7-12H2,1-6H3;8H,1-7H3 |
| InChIKey | NOMVHEJJZIINHX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 596.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane?
The IUPAC name of trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane (CID 87481356) is trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane.
What is the SMILES notation for trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane?
The canonical SMILES for trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane is CO[Si](CCCCCC[Si](OC)(OC)OC)(OC)OC.CO[Si](OC)(OC)C(C)[Si](OC)(OC)OC.
What is the InChIKey of trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane?
The InChIKey is NOMVHEJJZIINHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30O6Si2.C8H22O6Si2/c1-13-19(14-2,15-3)11-9-7-8-10-12-20(16-4,17-5)18-6;1-8(15(9-2,10-3)11-4)16(12-5,13-6)14-7/h7-12H2,1-6H3;8H,1-7H3.
What are the key properties of trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane?
trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane has a molecular weight of 596.97 g/mol, XLogP of 2.97, 21 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(1-trimethoxysilylethyl)silane;trimethoxy(6-trimethoxysilylhexyl)silane is sourced from PubChem (CID 87481356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).