C29H62O5Si2 — CID 87593412
1,17-bis[diethoxy(methyl)silyl]-8,10-dimethylheptadecan-9-one (PubChem CID 87593412) has the molecular formula C29H62O5Si2 and a molecular weight of 546.98 g/mol. Its IUPAC name is 1,17-bis[diethoxy(methyl)silyl]-8,10-dimethylheptadecan-9-one.
| Compound Name | 1,17-bis[diethoxy(methyl)silyl]-8,10-dimethylheptadecan-9-one |
|---|---|
| PubChem CID | 87593412 |
| Molecular Formula | C29H62O5Si2 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.41 |
| IUPAC Name | 1,17-bis[diethoxy(methyl)silyl]-8,10-dimethylheptadecan-9-one |
| SMILES | CCO[Si](C)(CCCCCCCC(C)C(=O)C(C)CCCCCCC[Si](C)(OCC)OCC)OCC |
| InChI | InChI=1S/C29H62O5Si2/c1-9-31-35(7,32-10-2)25-21-17-13-15-19-23-27(5)29(30)28(6)24-20-16-14-18-22-26-36(8,33-11-3)34-12-4/h27-28H,9-26H2,1-8H3 |
| InChIKey | NGQGEOSXKVDIGM-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|