C12H27NO3SSi — CID 23597776
3-[3-[diethoxy(methyl)silyl]propylsulfanyl]-2-methylpropanamide (PubChem CID 23597776) has the molecular formula C12H27NO3SSi and a molecular weight of 293.50 g/mol. Its IUPAC name is 3-[3-[diethoxy(methyl)silyl]propylsulfanyl]-2-methylpropanamide.
| Compound Name | 3-[3-[diethoxy(methyl)silyl]propylsulfanyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 23597776 |
| Molecular Formula | C12H27NO3SSi |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-[3-[diethoxy(methyl)silyl]propylsulfanyl]-2-methylpropanamide |
| SMILES | CCO[Si](C)(CCCSCC(C)C(N)=O)OCC |
| InChI | InChI=1S/C12H27NO3SSi/c1-5-15-18(4,16-6-2)9-7-8-17-10-11(3)12(13)14/h11H,5-10H2,1-4H3,(H2,13,14) |
| InChIKey | HKTQTJAYOHLVFU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|