C18H36N2O7S2Si — CID 58971354
[3-amino-2-methyl-3-oxo-2-(3-trimethoxysilylpropylsulfanylmethyl)propyl] 3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoate (PubChem CID 58971354) has the molecular formula C18H36N2O7S2Si and a molecular weight of 484.71 g/mol. Its IUPAC name is [3-amino-2-methyl-3-oxo-2-(3-trimethoxysilylpropylsulfanylmethyl)propyl] 3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoate.
| Compound Name | [3-amino-2-methyl-3-oxo-2-(3-trimethoxysilylpropylsulfanylmethyl)propyl] 3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 58971354 |
| Molecular Formula | C18H36N2O7S2Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [3-amino-2-methyl-3-oxo-2-(3-trimethoxysilylpropylsulfanylmethyl)propyl] 3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoate |
| SMILES | CO[Si](CCCSCC(C)(COC(=O)CCSCC(C)C(N)=O)C(N)=O)(OC)OC |
| InChI | InChI=1S/C18H36N2O7S2Si/c1-14(16(19)22)11-28-9-7-15(21)27-12-18(2,17(20)23)13-29-8-6-10-30(24-3,25-4)26-5/h14H,6-13H2,1-5H3,(H2,19,22)(H2,20,23) |
| InChIKey | GSOHLLSZPULVLP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|