C20H45NO4Si2 — CID 88852273
triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]-2-methylpropanoate (PubChem CID 88852273) has the molecular formula C20H45NO4Si2 and a molecular weight of 419.76 g/mol. Its IUPAC name is triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]-2-methylpropanoate.
| Compound Name | triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 88852273 |
| Molecular Formula | C20H45NO4Si2 |
| Molecular Weight | 419.76 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]-2-methylpropanoate |
| SMILES | CCO[Si](C)(CCCN(CC)CC(C)C(=O)O[Si](CC)(CC)CC)OCC |
| InChI | InChI=1S/C20H45NO4Si2/c1-9-21(16-15-17-26(8,23-10-2)24-11-3)18-19(7)20(22)25-27(12-4,13-5)14-6/h19H,9-18H2,1-8H3 |
| InChIKey | CSJDIPLXOWEAEC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|