C17H41NO3Si3 — CID 88852108
trimethylsilyl 3-[3-[ethoxy(dimethyl)silyl]propyl-trimethylsilylamino]-2-methylpropanoate (PubChem CID 88852108) has the molecular formula C17H41NO3Si3 and a molecular weight of 391.78 g/mol. Its IUPAC name is trimethylsilyl 3-[3-[ethoxy(dimethyl)silyl]propyl-trimethylsilylamino]-2-methylpropanoate.
| Compound Name | trimethylsilyl 3-[3-[ethoxy(dimethyl)silyl]propyl-trimethylsilylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 88852108 |
| Molecular Formula | C17H41NO3Si3 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | trimethylsilyl 3-[3-[ethoxy(dimethyl)silyl]propyl-trimethylsilylamino]-2-methylpropanoate |
| SMILES | CCO[Si](C)(C)CCCN(CC(C)C(=O)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H41NO3Si3/c1-11-20-24(9,10)14-12-13-18(22(3,4)5)15-16(2)17(19)21-23(6,7)8/h16H,11-15H2,1-10H3 |
| InChIKey | SXSUJCWBWAJVBQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|