C14H33NO3Si2 — CID 88852006
trimethylsilyl 3-[3-[methoxy(dimethyl)silyl]propyl-methylamino]-2-methylpropanoate (PubChem CID 88852006) has the molecular formula C14H33NO3Si2 and a molecular weight of 319.59 g/mol. Its IUPAC name is trimethylsilyl 3-[3-[methoxy(dimethyl)silyl]propyl-methylamino]-2-methylpropanoate.
| Compound Name | trimethylsilyl 3-[3-[methoxy(dimethyl)silyl]propyl-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 88852006 |
| Molecular Formula | C14H33NO3Si2 |
| Molecular Weight | 319.59 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | trimethylsilyl 3-[3-[methoxy(dimethyl)silyl]propyl-methylamino]-2-methylpropanoate |
| SMILES | CO[Si](C)(C)CCCN(C)CC(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H33NO3Si2/c1-13(14(16)18-19(4,5)6)12-15(2)10-9-11-20(7,8)17-3/h13H,9-12H2,1-8H3 |
| InChIKey | DDSYAOQLYTVQAZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|