C17H39NO7Si3 — CID 88852299
bis(trimethylsilyl) 2-[methyl(3-trimethoxysilylpropyl)amino]butanedioate (PubChem CID 88852299) has the molecular formula C17H39NO7Si3 and a molecular weight of 453.76 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-[methyl(3-trimethoxysilylpropyl)amino]butanedioate.
| Compound Name | bis(trimethylsilyl) 2-[methyl(3-trimethoxysilylpropyl)amino]butanedioate |
|---|---|
| PubChem CID | 88852299 |
| Molecular Formula | C17H39NO7Si3 |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | bis(trimethylsilyl) 2-[methyl(3-trimethoxysilylpropyl)amino]butanedioate |
| SMILES | CO[Si](CCCN(C)C(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C17H39NO7Si3/c1-18(12-11-13-28(21-2,22-3)23-4)15(17(20)25-27(8,9)10)14-16(19)24-26(5,6)7/h15H,11-14H2,1-10H3 |
| InChIKey | LRBYGJPPEXNALM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|