C11H23NO6Si — CID 88852181
2-[3-[dimethoxy(methyl)silyl]propyl-methylamino]butanedioic acid (PubChem CID 88852181) has the molecular formula C11H23NO6Si and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[3-[dimethoxy(methyl)silyl]propyl-methylamino]butanedioic acid.
| Compound Name | 2-[3-[dimethoxy(methyl)silyl]propyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 88852181 |
| Molecular Formula | C11H23NO6Si |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[3-[dimethoxy(methyl)silyl]propyl-methylamino]butanedioic acid |
| SMILES | CO[Si](C)(CCCN(C)C(CC(=O)O)C(=O)O)OC |
| InChI | InChI=1S/C11H23NO6Si/c1-12(9(11(15)16)8-10(13)14)6-5-7-19(4,17-2)18-3/h9H,5-8H2,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | WMJNBDFNXKNGCE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|