C13H26N2O6S — CID 20719373
3-[4-[3,3-dihydroxypropyl(methyl)amino]butyl-methylamino]-4-oxo-4-sulfanyloxybutanoic acid (PubChem CID 20719373) has the molecular formula C13H26N2O6S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-[4-[3,3-dihydroxypropyl(methyl)amino]butyl-methylamino]-4-oxo-4-sulfanyloxybutanoic acid.
| Compound Name | 3-[4-[3,3-dihydroxypropyl(methyl)amino]butyl-methylamino]-4-oxo-4-sulfanyloxybutanoic acid |
|---|---|
| PubChem CID | 20719373 |
| Molecular Formula | C13H26N2O6S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[4-[3,3-dihydroxypropyl(methyl)amino]butyl-methylamino]-4-oxo-4-sulfanyloxybutanoic acid |
| SMILES | CN(CCCCN(C)C(CC(=O)O)C(=O)OS)CCC(O)O |
| InChI | InChI=1S/C13H26N2O6S/c1-14(8-5-11(16)17)6-3-4-7-15(2)10(9-12(18)19)13(20)21-22/h10-11,16-17,22H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | XMXCJTZJMUIZNH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|