C12H25NO6Si — CID 88852321
(2S)-2-[3-[dimethoxy(methyl)silyl]propyl-ethylamino]butanedioic acid (PubChem CID 88852321) has the molecular formula C12H25NO6Si and a molecular weight of 307.42 g/mol. Its IUPAC name is (2S)-2-[3-[dimethoxy(methyl)silyl]propyl-ethylamino]butanedioic acid.
| Compound Name | (2S)-2-[3-[dimethoxy(methyl)silyl]propyl-ethylamino]butanedioic acid |
|---|---|
| PubChem CID | 88852321 |
| Molecular Formula | C12H25NO6Si |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (2S)-2-[3-[dimethoxy(methyl)silyl]propyl-ethylamino]butanedioic acid |
| SMILES | CCN(CCC[Si](C)(OC)OC)[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H25NO6Si/c1-5-13(10(12(16)17)9-11(14)15)7-6-8-20(4,18-2)19-3/h10H,5-9H2,1-4H3,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | JOHDSRBCZDAOOC-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|