C19H40N2O5Si — CID 158252099
2-[2-[3-[dimethoxy(methyl)silyl]propyl-propylamino]-2-oxoethoxy]-N,N-dipropylacetamide (PubChem CID 158252099) has the molecular formula C19H40N2O5Si and a molecular weight of 404.62 g/mol. Its IUPAC name is 2-[2-[3-[dimethoxy(methyl)silyl]propyl-propylamino]-2-oxoethoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[2-[3-[dimethoxy(methyl)silyl]propyl-propylamino]-2-oxoethoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 158252099 |
| Molecular Formula | C19H40N2O5Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2-[2-[3-[dimethoxy(methyl)silyl]propyl-propylamino]-2-oxoethoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COCC(=O)N(CCC)CCC[Si](C)(OC)OC |
| InChI | InChI=1S/C19H40N2O5Si/c1-7-11-20(12-8-2)18(22)16-26-17-19(23)21(13-9-3)14-10-15-27(6,24-4)25-5/h7-17H2,1-6H3 |
| InChIKey | VVUCOSBGQPCPDG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|