C14H28NO6S+ — CID 172785253
4-[[(1S)-1,2-dicarboxyethyl]-ethylamino]butan-2-yl-diethoxysulfanium (PubChem CID 172785253) has the molecular formula C14H28NO6S+ and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[[(1S)-1,2-dicarboxyethyl]-ethylamino]butan-2-yl-diethoxysulfanium.
| Compound Name | 4-[[(1S)-1,2-dicarboxyethyl]-ethylamino]butan-2-yl-diethoxysulfanium |
|---|---|
| PubChem CID | 172785253 |
| Molecular Formula | C14H28NO6S+ |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[[(1S)-1,2-dicarboxyethyl]-ethylamino]butan-2-yl-diethoxysulfanium |
| SMILES | CCO[S+](OCC)C(C)CCN(CC)[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H27NO6S/c1-5-15(12(14(18)19)10-13(16)17)9-8-11(4)22(20-6-2)21-7-3/h11-12H,5-10H2,1-4H3,(H-,16,17,18,19)/p+1/t11?,12-/m0/s1 |
| InChIKey | OUNJCFLCHRNIFW-KIYNQFGBSA-O |
| XLogP | 1.54 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|