C8H16N2O6 — CID 89312216
2-[2-aminoethyl(2,2-dihydroxyethyl)amino]butanedioic acid (PubChem CID 89312216) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-dihydroxyethyl)amino]butanedioic acid.
| Compound Name | 2-[2-aminoethyl(2,2-dihydroxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 89312216 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[2-aminoethyl(2,2-dihydroxyethyl)amino]butanedioic acid |
| SMILES | NCCN(CC(O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O6/c9-1-2-10(4-7(13)14)5(8(15)16)3-6(11)12/h5,7,13-14H,1-4,9H2,(H,11,12)(H,15,16) |
| InChIKey | NVKJLVPIZUCBKG-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|