C5H9N3O5 — CID 174439838
2-[amino(carbamoyl)amino]butanedioic acid (PubChem CID 174439838) has the molecular formula C5H9N3O5 and a molecular weight of 191.14 g/mol. Its IUPAC name is 2-[amino(carbamoyl)amino]butanedioic acid.
| Compound Name | 2-[amino(carbamoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 174439838 |
| Molecular Formula | C5H9N3O5 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-[amino(carbamoyl)amino]butanedioic acid |
| SMILES | NC(=O)N(N)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9N3O5/c6-5(13)8(7)2(4(11)12)1-3(9)10/h2H,1,7H2,(H2,6,13)(H,9,10)(H,11,12) |
| InChIKey | CKQODYMQQGGSMF-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|