C12H19NO8 — CID 139720141
(2S)-2-[bis(2-carboxypropyl)amino]butanedioic acid (PubChem CID 139720141) has the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. Its IUPAC name is (2S)-2-[bis(2-carboxypropyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[bis(2-carboxypropyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 139720141 |
| Molecular Formula | C12H19NO8 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (2S)-2-[bis(2-carboxypropyl)amino]butanedioic acid |
| SMILES | CC(CN(CC(C)C(=O)O)[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19NO8/c1-6(10(16)17)4-13(5-7(2)11(18)19)8(12(20)21)3-9(14)15/h6-8H,3-5H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21)/t6?,7?,8-/m0/s1 |
| InChIKey | KJYIUAIYHMZPEH-RRQHEKLDSA-N |
| XLogP | -0.34 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |