C11H14BrNO4S — CID 115144485
2-[2-(4-bromothiophen-2-yl)ethyl-methylamino]butanedioic acid (PubChem CID 115144485) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is 2-[2-(4-bromothiophen-2-yl)ethyl-methylamino]butanedioic acid.
| Compound Name | 2-[2-(4-bromothiophen-2-yl)ethyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 115144485 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-[2-(4-bromothiophen-2-yl)ethyl-methylamino]butanedioic acid |
| SMILES | CN(CCc1cc(Br)cs1)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14BrNO4S/c1-13(9(11(16)17)5-10(14)15)3-2-8-4-7(12)6-18-8/h4,6,9H,2-3,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | BLIQEUVFRSJTMA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |