C11H14BrNO3S — CID 115164633
4-[(4-bromothiophen-2-yl)methyl-methylamino]-3-methyl-4-oxobutanoic acid (PubChem CID 115164633) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methyl-methylamino]-3-methyl-4-oxobutanoic acid.
| Compound Name | 4-[(4-bromothiophen-2-yl)methyl-methylamino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115164633 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methyl-methylamino]-3-methyl-4-oxobutanoic acid |
| SMILES | CC(CC(=O)O)C(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-7(3-10(14)15)11(16)13(2)5-9-4-8(12)6-17-9/h4,6-7H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | ILJLROZBDMHENK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |