C13H19BrN2O3S — CID 78976487
(2R)-2-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-methylpentanoic acid (PubChem CID 78976487) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is (2R)-2-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78976487 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2R)-2-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)N(C)Cc1cc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C13H19BrN2O3S/c1-8(2)4-11(12(17)18)15-13(19)16(3)6-10-5-9(14)7-20-10/h5,7-8,11H,4,6H2,1-3H3,(H,15,19)(H,17,18)/t11-/m1/s1 |
| InChIKey | ZFCIIEHXNZAGOH-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |