C10H13BrN2O4S — CID 114007343
(2S)-3-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid (PubChem CID 114007343) has the molecular formula C10H13BrN2O4S and a molecular weight of 337.20 g/mol. Its IUPAC name is (2S)-3-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 114007343 |
| Molecular Formula | C10H13BrN2O4S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | (2S)-3-[[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O4S/c1-13(4-7-2-6(11)5-18-7)10(17)12-3-8(14)9(15)16/h2,5,8,14H,3-4H2,1H3,(H,12,17)(H,15,16)/t8-/m0/s1 |
| InChIKey | QWZRKKGDQXIDBY-QMMMGPOBSA-N |
| XLogP | 1.10 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |