C10H14N2O5 — CID 107838816
(2S)-3-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-2-hydroxypropanoic acid (PubChem CID 107838816) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is (2S)-3-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107838816 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2S)-3-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CN(Cc1ccoc1)C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C10H14N2O5/c1-12(5-7-2-3-17-6-7)10(16)11-4-8(13)9(14)15/h2-3,6,8,13H,4-5H2,1H3,(H,11,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | QLQVLRHVHVRLKA-QMMMGPOBSA-N |
| XLogP | -0.13 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |