C12H16N2O6 — CID 63304810
(2S)-2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63304810) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2S)-2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63304810 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2S)-2-[[furan-3-ylmethyl(methyl)carbamoyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)N(C)Cc1ccoc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O6/c1-14(6-8-3-4-20-7-8)12(18)13-9(11(16)17)5-10(15)19-2/h3-4,7,9H,5-6H2,1-2H3,(H,13,18)(H,16,17)/t9-/m0/s1 |
| InChIKey | CRNZOIOMWSVXJX-VIFPVBQESA-N |
| XLogP | 0.44 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |