C7H10N2O3 — CID 54330793
1-(furan-3-ylmethyl)-3-hydroxy-1-methylurea (PubChem CID 54330793) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-hydroxy-1-methylurea.
| Compound Name | 1-(furan-3-ylmethyl)-3-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 54330793 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-hydroxy-1-methylurea |
| SMILES | CN(Cc1ccoc1)C(=O)NO |
| InChI | InChI=1S/C7H10N2O3/c1-9(7(10)8-11)4-6-2-3-12-5-6/h2-3,5,11H,4H2,1H3,(H,8,10) |
| InChIKey | SYEYAJRZSXQBCO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|