C15H15BrFNO2S — CID 47042167
N-[(4-bromothiophen-2-yl)methyl]-2-(4-fluorophenoxy)-N-methylpropanamide (PubChem CID 47042167) has the molecular formula C15H15BrFNO2S and a molecular weight of 372.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(4-fluorophenoxy)-N-methylpropanamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-fluorophenoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 47042167 |
| Molecular Formula | C15H15BrFNO2S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-fluorophenoxy)-N-methylpropanamide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C15H15BrFNO2S/c1-10(20-13-5-3-12(17)4-6-13)15(19)18(2)8-14-7-11(16)9-21-14/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | VQPHEKPFBDZWNL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |