C17H18FNO5 — CID 119221714
5-[[2-(4-fluorophenoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119221714) has the molecular formula C17H18FNO5 and a molecular weight of 335.33 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[2-(4-fluorophenoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119221714 |
| Molecular Formula | C17H18FNO5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 5-[[2-(4-fluorophenoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)C(=O)C(C)Oc2ccc(F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C17H18FNO5/c1-10-15(17(21)22)8-14(23-10)9-19(3)16(20)11(2)24-13-6-4-12(18)5-7-13/h4-8,11H,9H2,1-3H3,(H,21,22) |
| InChIKey | LASGBBOWXZHMCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |