C17H18FNO4 — CID 119222703
5-[[2-(3-fluorophenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119222703) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is 5-[[2-(3-fluorophenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[2-(3-fluorophenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119222703 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-[[2-(3-fluorophenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)C(=O)C(C)c2cccc(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C17H18FNO4/c1-10(12-5-4-6-13(18)7-12)16(20)19(3)9-14-8-15(17(21)22)11(2)23-14/h4-8,10H,9H2,1-3H3,(H,21,22) |
| InChIKey | OVMHJTGAZXZPCU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |