C9H11BrO4S2 — CID 66115021
3-[(4-bromothiophen-2-yl)methylsulfonyl]butanoic acid (PubChem CID 66115021) has the molecular formula C9H11BrO4S2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methylsulfonyl]butanoic acid.
| Compound Name | 3-[(4-bromothiophen-2-yl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 66115021 |
| Molecular Formula | C9H11BrO4S2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methylsulfonyl]butanoic acid |
| SMILES | CC(CC(=O)O)S(=O)(=O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrO4S2/c1-6(2-9(11)12)16(13,14)5-8-3-7(10)4-15-8/h3-4,6H,2,5H2,1H3,(H,11,12) |
| InChIKey | ZRQSAJGZMHPDEW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |