C12H15BrO5S — CID 66114579
3-[2-(3-bromophenoxy)ethylsulfonyl]butanoic acid (PubChem CID 66114579) has the molecular formula C12H15BrO5S and a molecular weight of 351.22 g/mol. Its IUPAC name is 3-[2-(3-bromophenoxy)ethylsulfonyl]butanoic acid.
| Compound Name | 3-[2-(3-bromophenoxy)ethylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 66114579 |
| Molecular Formula | C12H15BrO5S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 3-[2-(3-bromophenoxy)ethylsulfonyl]butanoic acid |
| SMILES | CC(CC(=O)O)S(=O)(=O)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrO5S/c1-9(7-12(14)15)19(16,17)6-5-18-11-4-2-3-10(13)8-11/h2-4,8-9H,5-7H2,1H3,(H,14,15) |
| InChIKey | COOIEXSIZXTABR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |