C14H18BrNO4 — CID 62821216
3-[[2-(3-bromophenoxy)acetyl]-ethylamino]butanoic acid (PubChem CID 62821216) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-[[2-(3-bromophenoxy)acetyl]-ethylamino]butanoic acid.
| Compound Name | 3-[[2-(3-bromophenoxy)acetyl]-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 62821216 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[[2-(3-bromophenoxy)acetyl]-ethylamino]butanoic acid |
| SMILES | CCN(C(=O)COc1cccc(Br)c1)C(C)CC(=O)O |
| InChI | InChI=1S/C14H18BrNO4/c1-3-16(10(2)7-14(18)19)13(17)9-20-12-6-4-5-11(15)8-12/h4-6,8,10H,3,7,9H2,1-2H3,(H,18,19) |
| InChIKey | ZBZYFKNXLPVING-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |