C9H11BrO3S2 — CID 64916357
3-[(4-bromothiophen-2-yl)methylsulfinyl]-2-methylpropanoic acid (PubChem CID 64916357) has the molecular formula C9H11BrO3S2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methylsulfinyl]-2-methylpropanoic acid.
| Compound Name | 3-[(4-bromothiophen-2-yl)methylsulfinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64916357 |
| Molecular Formula | C9H11BrO3S2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methylsulfinyl]-2-methylpropanoic acid |
| SMILES | CC(CS(=O)Cc1cc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C9H11BrO3S2/c1-6(9(11)12)4-15(13)5-8-2-7(10)3-14-8/h2-3,6H,4-5H2,1H3,(H,11,12) |
| InChIKey | DJOFTUYPFKEZDT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |