C12H15NO5 — CID 115144312
2-(4-methoxy-N-methylanilino)butanedioic acid (PubChem CID 115144312) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-(4-methoxy-N-methylanilino)butanedioic acid.
| Compound Name | 2-(4-methoxy-N-methylanilino)butanedioic acid |
|---|---|
| PubChem CID | 115144312 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(4-methoxy-N-methylanilino)butanedioic acid |
| SMILES | COc1ccc(N(C)C(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO5/c1-13(10(12(16)17)7-11(14)15)8-3-5-9(18-2)6-4-8/h3-6,10H,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | JBNHWTAMRAULTL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|