C24H53NO5Si3 — CID 88852131
bis(triethylsilyl) 2-[3-[ethoxy(dimethyl)silyl]propyl-methylamino]butanedioate (PubChem CID 88852131) has the molecular formula C24H53NO5Si3 and a molecular weight of 519.95 g/mol. Its IUPAC name is bis(triethylsilyl) 2-[3-[ethoxy(dimethyl)silyl]propyl-methylamino]butanedioate.
| Compound Name | bis(triethylsilyl) 2-[3-[ethoxy(dimethyl)silyl]propyl-methylamino]butanedioate |
|---|---|
| PubChem CID | 88852131 |
| Molecular Formula | C24H53NO5Si3 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | bis(triethylsilyl) 2-[3-[ethoxy(dimethyl)silyl]propyl-methylamino]butanedioate |
| SMILES | CCO[Si](C)(C)CCCN(C)C(CC(=O)O[Si](CC)(CC)CC)C(=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H53NO5Si3/c1-11-28-31(9,10)20-18-19-25(8)22(24(27)30-33(15-5,16-6)17-7)21-23(26)29-32(12-2,13-3)14-4/h22H,11-21H2,1-10H3 |
| InChIKey | DJTKWUDXANGKJY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|