C21H49NO4Si3 — CID 140591135
triethylsilyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-trimethylsilylamino]acetate (PubChem CID 140591135) has the molecular formula C21H49NO4Si3 and a molecular weight of 463.88 g/mol. Its IUPAC name is triethylsilyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-trimethylsilylamino]acetate.
| Compound Name | triethylsilyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-trimethylsilylamino]acetate |
|---|---|
| PubChem CID | 140591135 |
| Molecular Formula | C21H49NO4Si3 |
| Molecular Weight | 463.88 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | triethylsilyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-trimethylsilylamino]acetate |
| SMILES | CCO[Si](C)(CCCN(CC(=O)O[Si](CC)(CC)CC)[Si](C)(C)C)OC(C)CC |
| InChI | InChI=1S/C21H49NO4Si3/c1-11-20(6)25-28(10,24-12-2)18-16-17-22(27(7,8)9)19-21(23)26-29(13-3,14-4)15-5/h20H,11-19H2,1-10H3 |
| InChIKey | MYWNPPNJENCUES-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|