C17H39NO5Si2 — CID 140591318
trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-methylamino]acetate (PubChem CID 140591318) has the molecular formula C17H39NO5Si2 and a molecular weight of 393.67 g/mol. Its IUPAC name is trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-methylamino]acetate.
| Compound Name | trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-methylamino]acetate |
|---|---|
| PubChem CID | 140591318 |
| Molecular Formula | C17H39NO5Si2 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-methylamino]acetate |
| SMILES | CCO[Si](CCCN(C)CC(=O)O[Si](C)(C)C)(OCC)OC(C)CC |
| InChI | InChI=1S/C17H39NO5Si2/c1-9-16(4)22-25(20-10-2,21-11-3)14-12-13-18(5)15-17(19)23-24(6,7)8/h16H,9-15H2,1-8H3 |
| InChIKey | VDYJTRWCPPBTRS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|